C15H9F3INO4 — CID 45345893
5-iodo-2-[[4-(trifluoromethoxy)benzoyl]amino]benzoic acid (PubChem CID 45345893) has the molecular formula C15H9F3INO4 and a molecular weight of 451.14 g/mol. Its IUPAC name is 5-iodo-2-[[4-(trifluoromethoxy)benzoyl]amino]benzoic acid.
| Compound Name | 5-iodo-2-[[4-(trifluoromethoxy)benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 45345893 |
| Molecular Formula | C15H9F3INO4 |
| Molecular Weight | 451.14 g/mol |
| Exact Mass | 450.95 |
| IUPAC Name | 5-iodo-2-[[4-(trifluoromethoxy)benzoyl]amino]benzoic acid |
| SMILES | O=C(Nc1ccc(I)cc1C(=O)O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H9F3INO4/c16-15(17,18)24-10-4-1-8(2-5-10)13(21)20-12-6-3-9(19)7-11(12)14(22)23/h1-7H,(H,20,21)(H,22,23) |
| InChIKey | CGUMPIVDQOHLFV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.14 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|