C20H14F3NO4S — CID 20775718
3-[(4-methylbenzoyl)amino]-5-[4-(trifluoromethoxy)phenyl]thiophene-2-carboxylic acid (PubChem CID 20775718) has the molecular formula C20H14F3NO4S and a molecular weight of 421.40 g/mol. Its IUPAC name is 3-[(4-methylbenzoyl)amino]-5-[4-(trifluoromethoxy)phenyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[(4-methylbenzoyl)amino]-5-[4-(trifluoromethoxy)phenyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 20775718 |
| Molecular Formula | C20H14F3NO4S |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | 3-[(4-methylbenzoyl)amino]-5-[4-(trifluoromethoxy)phenyl]thiophene-2-carboxylic acid |
| SMILES | Cc1ccc(C(=O)Nc2cc(-c3ccc(OC(F)(F)F)cc3)sc2C(=O)O)cc1 |
| InChI | InChI=1S/C20H14F3NO4S/c1-11-2-4-13(5-3-11)18(25)24-15-10-16(29-17(15)19(26)27)12-6-8-14(9-7-12)28-20(21,22)23/h2-10H,1H3,(H,24,25)(H,26,27) |
| InChIKey | ZHNYWKXXBWLHRM-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |