C23H16F3N3O4S — CID 58874653
N-(2-sulfamoylphenyl)-4-[6-(trifluoromethoxy)quinolin-2-yl]benzamide (PubChem CID 58874653) has the molecular formula C23H16F3N3O4S and a molecular weight of 487.46 g/mol. Its IUPAC name is N-(2-sulfamoylphenyl)-4-[6-(trifluoromethoxy)quinolin-2-yl]benzamide.
| Compound Name | N-(2-sulfamoylphenyl)-4-[6-(trifluoromethoxy)quinolin-2-yl]benzamide |
|---|---|
| PubChem CID | 58874653 |
| Molecular Formula | C23H16F3N3O4S |
| Molecular Weight | 487.46 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | N-(2-sulfamoylphenyl)-4-[6-(trifluoromethoxy)quinolin-2-yl]benzamide |
| SMILES | NS(=O)(=O)c1ccccc1NC(=O)c1ccc(-c2ccc3cc(OC(F)(F)F)ccc3n2)cc1 |
| InChI | InChI=1S/C23H16F3N3O4S/c24-23(25,26)33-17-10-12-19-16(13-17)9-11-18(28-19)14-5-7-15(8-6-14)22(30)29-20-3-1-2-4-21(20)34(27,31)32/h1-13H,(H,29,30)(H2,27,31,32) |
| InChIKey | XWQABFWFMMPPSH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |