C31H24N2O6S — CID 18727915
methyl 3-[2-[[4-(2-sulfamoylphenyl)benzoyl]amino]phenoxy]naphthalene-2-carboxylate (PubChem CID 18727915) has the molecular formula C31H24N2O6S and a molecular weight of 552.61 g/mol. Its IUPAC name is methyl 3-[2-[[4-(2-sulfamoylphenyl)benzoyl]amino]phenoxy]naphthalene-2-carboxylate.
| Compound Name | methyl 3-[2-[[4-(2-sulfamoylphenyl)benzoyl]amino]phenoxy]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 18727915 |
| Molecular Formula | C31H24N2O6S |
| Molecular Weight | 552.61 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | methyl 3-[2-[[4-(2-sulfamoylphenyl)benzoyl]amino]phenoxy]naphthalene-2-carboxylate |
| SMILES | COC(=O)c1cc2ccccc2cc1Oc1ccccc1NC(=O)c1ccc(-c2ccccc2S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C31H24N2O6S/c1-38-31(35)25-18-22-8-2-3-9-23(22)19-28(25)39-27-12-6-5-11-26(27)33-30(34)21-16-14-20(15-17-21)24-10-4-7-13-29(24)40(32,36)37/h2-19H,1H3,(H,33,34)(H2,32,36,37) |
| InChIKey | CIFQXAYKMGIQNN-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.61 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |