C26H19N3O4S — CID 59871651
2-(3-isocyanophenoxy)-N-[4-(2-sulfamoylphenyl)phenyl]benzamide (PubChem CID 59871651) has the molecular formula C26H19N3O4S and a molecular weight of 469.52 g/mol. Its IUPAC name is 2-(3-isocyanophenoxy)-N-[4-(2-sulfamoylphenyl)phenyl]benzamide.
| Compound Name | 2-(3-isocyanophenoxy)-N-[4-(2-sulfamoylphenyl)phenyl]benzamide |
|---|---|
| PubChem CID | 59871651 |
| Molecular Formula | C26H19N3O4S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 2-(3-isocyanophenoxy)-N-[4-(2-sulfamoylphenyl)phenyl]benzamide |
| SMILES | [C-]#[N+]c1cccc(Oc2ccccc2C(=O)Nc2ccc(-c3ccccc3S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C26H19N3O4S/c1-28-20-7-6-8-21(17-20)33-24-11-4-2-10-23(24)26(30)29-19-15-13-18(14-16-19)22-9-3-5-12-25(22)34(27,31)32/h2-17H,(H,29,30)(H2,27,31,32) |
| InChIKey | WESQFVFHEBCLAG-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|