C28H24N4O3S — CID 70670862
4-acetamido-2-(3-carbamimidoylphenoxy)-N-[4-(2-sulfanylphenyl)phenyl]benzamide (PubChem CID 70670862) has the molecular formula C28H24N4O3S and a molecular weight of 496.59 g/mol. Its IUPAC name is 4-acetamido-2-(3-carbamimidoylphenoxy)-N-[4-(2-sulfanylphenyl)phenyl]benzamide.
| Compound Name | 4-acetamido-2-(3-carbamimidoylphenoxy)-N-[4-(2-sulfanylphenyl)phenyl]benzamide |
|---|---|
| PubChem CID | 70670862 |
| Molecular Formula | C28H24N4O3S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 4-acetamido-2-(3-carbamimidoylphenoxy)-N-[4-(2-sulfanylphenyl)phenyl]benzamide |
| SMILES | [H]/N=C(\N)c1cccc(Oc2cc(NC(C)=O)ccc2C(=O)Nc2ccc(-c3ccccc3S)cc2)c1 |
| InChI | InChI=1S/C28H24N4O3S/c1-17(33)31-21-13-14-24(25(16-21)35-22-6-4-5-19(15-22)27(29)30)28(34)32-20-11-9-18(10-12-20)23-7-2-3-8-26(23)36/h2-16,36H,1H3,(H3,29,30)(H,31,33)(H,32,34) |
| InChIKey | KJOHIQAHZRDCAI-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|