C25H22N4O2S2 — CID 70670944
N-(3-carbamimidoylphenyl)-4-[[4-(2-sulfanylphenyl)benzoyl]amino]-2,3-dihydrothiophene-5-carboxamide (PubChem CID 70670944) has the molecular formula C25H22N4O2S2 and a molecular weight of 474.61 g/mol. Its IUPAC name is N-(3-carbamimidoylphenyl)-4-[[4-(2-sulfanylphenyl)benzoyl]amino]-2,3-dihydrothiophene-5-carboxamide.
| Compound Name | N-(3-carbamimidoylphenyl)-4-[[4-(2-sulfanylphenyl)benzoyl]amino]-2,3-dihydrothiophene-5-carboxamide |
|---|---|
| PubChem CID | 70670944 |
| Molecular Formula | C25H22N4O2S2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | N-(3-carbamimidoylphenyl)-4-[[4-(2-sulfanylphenyl)benzoyl]amino]-2,3-dihydrothiophene-5-carboxamide |
| SMILES | [H]/N=C(\N)c1cccc(NC(=O)C2=C(NC(=O)c3ccc(-c4ccccc4S)cc3)CCS2)c1 |
| InChI | InChI=1S/C25H22N4O2S2/c26-23(27)17-4-3-5-18(14-17)28-25(31)22-20(12-13-33-22)29-24(30)16-10-8-15(9-11-16)19-6-1-2-7-21(19)32/h1-11,14,32H,12-13H2,(H3,26,27)(H,28,31)(H,29,30) |
| InChIKey | QLYVOQHPJZRNFZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|