C27H25N5O3S — CID 10278610
2-(3-carbamimidoylanilino)-2-phenyl-N-[4-(2-sulfamoylphenyl)phenyl]acetamide (PubChem CID 10278610) has the molecular formula C27H25N5O3S and a molecular weight of 499.60 g/mol. Its IUPAC name is 2-(3-carbamimidoylanilino)-2-phenyl-N-[4-(2-sulfamoylphenyl)phenyl]acetamide.
| Compound Name | 2-(3-carbamimidoylanilino)-2-phenyl-N-[4-(2-sulfamoylphenyl)phenyl]acetamide |
|---|---|
| PubChem CID | 10278610 |
| Molecular Formula | C27H25N5O3S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 2-(3-carbamimidoylanilino)-2-phenyl-N-[4-(2-sulfamoylphenyl)phenyl]acetamide |
| SMILES | [H]/N=C(\N)c1cccc(NC(C(=O)Nc2ccc(-c3ccccc3S(N)(=O)=O)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C27H25N5O3S/c28-26(29)20-9-6-10-22(17-20)31-25(19-7-2-1-3-8-19)27(33)32-21-15-13-18(14-16-21)23-11-4-5-12-24(23)36(30,34)35/h1-17,25,31H,(H3,28,29)(H,32,33)(H2,30,34,35) |
| InChIKey | JSPSSBDPQIOWRU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 151.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|