C25H29N5O3S — CID 151802452
(3S)-3-(3-carbamimidoylanilino)-4-methyl-N-[4-(2-sulfamoylphenyl)phenyl]pentanamide (PubChem CID 151802452) has the molecular formula C25H29N5O3S and a molecular weight of 479.61 g/mol. Its IUPAC name is (3S)-3-(3-carbamimidoylanilino)-4-methyl-N-[4-(2-sulfamoylphenyl)phenyl]pentanamide.
| Compound Name | (3S)-3-(3-carbamimidoylanilino)-4-methyl-N-[4-(2-sulfamoylphenyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 151802452 |
| Molecular Formula | C25H29N5O3S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | (3S)-3-(3-carbamimidoylanilino)-4-methyl-N-[4-(2-sulfamoylphenyl)phenyl]pentanamide |
| SMILES | [H]/N=C(\N)c1cccc(N[C@@H](CC(=O)Nc2ccc(-c3ccccc3S(N)(=O)=O)cc2)C(C)C)c1 |
| InChI | InChI=1S/C25H29N5O3S/c1-16(2)22(29-20-7-5-6-18(14-20)25(26)27)15-24(31)30-19-12-10-17(11-13-19)21-8-3-4-9-23(21)34(28,32)33/h3-14,16,22,29H,15H2,1-2H3,(H3,26,27)(H,30,31)(H2,28,32,33)/t22-/m0/s1 |
| InChIKey | RYXCOBUIORTASP-QFIPXVFZSA-N |
| XLogP | 3.75 |
| TPSA | 151.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|