C24H29N5O5S — CID 173252952
3-[[(2S)-butan-2-yl]amino]-N'-hydroxybenzenecarboximidamide;[4-(2-sulfamoylphenyl)phenyl]carbamic acid (PubChem CID 173252952) has the molecular formula C24H29N5O5S and a molecular weight of 499.59 g/mol. Its IUPAC name is 3-[[(2S)-butan-2-yl]amino]-N'-hydroxybenzenecarboximidamide;[4-(2-sulfamoylphenyl)phenyl]carbamic acid.
| Compound Name | 3-[[(2S)-butan-2-yl]amino]-N'-hydroxybenzenecarboximidamide;[4-(2-sulfamoylphenyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 173252952 |
| Molecular Formula | C24H29N5O5S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 3-[[(2S)-butan-2-yl]amino]-N'-hydroxybenzenecarboximidamide;[4-(2-sulfamoylphenyl)phenyl]carbamic acid |
| SMILES | CC[C@H](C)Nc1cccc(C(N)=NO)c1.NS(=O)(=O)c1ccccc1-c1ccc(NC(=O)O)cc1 |
| InChI | InChI=1S/C13H12N2O4S.C11H17N3O/c14-20(18,19)12-4-2-1-3-11(12)9-5-7-10(8-6-9)15-13(16)17;1-3-8(2)13-10-6-4-5-9(7-10)11(12)14-15/h1-8,15H,(H,16,17)(H2,14,18,19);4-8,13,15H,3H2,1-2H3,(H2,12,14)/t;8-/m.0/s1 |
| InChIKey | FYTLBTCQIDRIMF-WDBKTSHHSA-N |
| XLogP | 4.08 |
| TPSA | 180.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|