C23H21FN4O4S — CID 177496755
(E)-2-fluoro-3-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-N-[4-(2-sulfamoylphenyl)phenyl]but-2-enamide (PubChem CID 177496755) has the molecular formula C23H21FN4O4S and a molecular weight of 468.51 g/mol. Its IUPAC name is (E)-2-fluoro-3-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-N-[4-(2-sulfamoylphenyl)phenyl]but-2-enamide.
| Compound Name | (E)-2-fluoro-3-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-N-[4-(2-sulfamoylphenyl)phenyl]but-2-enamide |
|---|---|
| PubChem CID | 177496755 |
| Molecular Formula | C23H21FN4O4S |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | (E)-2-fluoro-3-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-N-[4-(2-sulfamoylphenyl)phenyl]but-2-enamide |
| SMILES | C/C(=C(\F)C(=O)Nc1ccc(-c2ccccc2S(N)(=O)=O)cc1)c1ccc(/C(N)=N/O)cc1 |
| InChI | InChI=1S/C23H21FN4O4S/c1-14(15-6-8-17(9-7-15)22(25)28-30)21(24)23(29)27-18-12-10-16(11-13-18)19-4-2-3-5-20(19)33(26,31)32/h2-13,30H,1H3,(H2,25,28)(H,27,29)(H2,26,31,32)/b21-14+ |
| InChIKey | JAHVUMLZCDNURR-KGENOOAVSA-N |
| XLogP | 3.43 |
| TPSA | 147.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|