C28H27N3O2S — CID 142050883
2-[4-[[(E)-1-naphthalen-2-yl-1-(propan-2-ylideneamino)prop-1-en-2-yl]amino]phenyl]benzenesulfonamide (PubChem CID 142050883) has the molecular formula C28H27N3O2S and a molecular weight of 469.61 g/mol. Its IUPAC name is 2-[4-[[(E)-1-naphthalen-2-yl-1-(propan-2-ylideneamino)prop-1-en-2-yl]amino]phenyl]benzenesulfonamide.
| Compound Name | 2-[4-[[(E)-1-naphthalen-2-yl-1-(propan-2-ylideneamino)prop-1-en-2-yl]amino]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 142050883 |
| Molecular Formula | C28H27N3O2S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 2-[4-[[(E)-1-naphthalen-2-yl-1-(propan-2-ylideneamino)prop-1-en-2-yl]amino]phenyl]benzenesulfonamide |
| SMILES | CC(C)=N/C(=C(\C)Nc1ccc(-c2ccccc2S(N)(=O)=O)cc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H27N3O2S/c1-19(2)30-28(24-13-12-21-8-4-5-9-23(21)18-24)20(3)31-25-16-14-22(15-17-25)26-10-6-7-11-27(26)34(29,32)33/h4-18,31H,1-3H3,(H2,29,32,33)/b28-20+ |
| InChIKey | HMXQQXLNEYDASQ-VFCFBJKWSA-N |
| XLogP | 6.44 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|