C23H20N4O4S — CID 10114682
2-(1-aminoisoquinolin-7-yl)oxy-N-[4-(2-sulfamoylphenyl)phenyl]acetamide (PubChem CID 10114682) has the molecular formula C23H20N4O4S and a molecular weight of 448.50 g/mol. Its IUPAC name is 2-(1-aminoisoquinolin-7-yl)oxy-N-[4-(2-sulfamoylphenyl)phenyl]acetamide.
| Compound Name | 2-(1-aminoisoquinolin-7-yl)oxy-N-[4-(2-sulfamoylphenyl)phenyl]acetamide |
|---|---|
| PubChem CID | 10114682 |
| Molecular Formula | C23H20N4O4S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 2-(1-aminoisoquinolin-7-yl)oxy-N-[4-(2-sulfamoylphenyl)phenyl]acetamide |
| SMILES | Nc1nccc2ccc(OCC(=O)Nc3ccc(-c4ccccc4S(N)(=O)=O)cc3)cc12 |
| InChI | InChI=1S/C23H20N4O4S/c24-23-20-13-18(10-7-16(20)11-12-26-23)31-14-22(28)27-17-8-5-15(6-9-17)19-3-1-2-4-21(19)32(25,29)30/h1-13H,14H2,(H2,24,26)(H,27,28)(H2,25,29,30) |
| InChIKey | GSNPIKKCFYDFJU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 137.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |