C32H27N3O4S — CID 20870622
2-(7-carbamimidoylnaphthalen-2-yl)oxy-N-[4-(2-methylsulfonylphenyl)phenyl]-2-phenylacetamide (PubChem CID 20870622) has the molecular formula C32H27N3O4S and a molecular weight of 549.65 g/mol. Its IUPAC name is 2-(7-carbamimidoylnaphthalen-2-yl)oxy-N-[4-(2-methylsulfonylphenyl)phenyl]-2-phenylacetamide.
| Compound Name | 2-(7-carbamimidoylnaphthalen-2-yl)oxy-N-[4-(2-methylsulfonylphenyl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 20870622 |
| Molecular Formula | C32H27N3O4S |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | 2-(7-carbamimidoylnaphthalen-2-yl)oxy-N-[4-(2-methylsulfonylphenyl)phenyl]-2-phenylacetamide |
| SMILES | [H]/N=C(\N)c1ccc2ccc(OC(C(=O)Nc3ccc(-c4ccccc4S(C)(=O)=O)cc3)c3ccccc3)cc2c1 |
| InChI | InChI=1S/C32H27N3O4S/c1-40(37,38)29-10-6-5-9-28(29)22-13-16-26(17-14-22)35-32(36)30(23-7-3-2-4-8-23)39-27-18-15-21-11-12-24(31(33)34)19-25(21)20-27/h2-20,30H,1H3,(H3,33,34)(H,35,36) |
| InChIKey | PVRYPSSCLRSOOS-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 122.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|