C25H28N4O3S — CID 70081882
(2S)-2-(3-carbamimidoylanilino)-N-[4-(2-methylsulfonylphenyl)phenyl]pentanamide (PubChem CID 70081882) has the molecular formula C25H28N4O3S and a molecular weight of 464.59 g/mol. Its IUPAC name is (2S)-2-(3-carbamimidoylanilino)-N-[4-(2-methylsulfonylphenyl)phenyl]pentanamide.
| Compound Name | (2S)-2-(3-carbamimidoylanilino)-N-[4-(2-methylsulfonylphenyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 70081882 |
| Molecular Formula | C25H28N4O3S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | (2S)-2-(3-carbamimidoylanilino)-N-[4-(2-methylsulfonylphenyl)phenyl]pentanamide |
| SMILES | [H]/N=C(\N)c1cccc(N[C@@H](CCC)C(=O)Nc2ccc(-c3ccccc3S(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C25H28N4O3S/c1-3-7-22(28-20-9-6-8-18(16-20)24(26)27)25(30)29-19-14-12-17(13-15-19)21-10-4-5-11-23(21)33(2,31)32/h4-6,8-16,22,28H,3,7H2,1-2H3,(H3,26,27)(H,29,30)/t22-/m0/s1 |
| InChIKey | DHGNSWSHEBPQAF-QFIPXVFZSA-N |
| XLogP | 4.26 |
| TPSA | 125.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|