C27H32N4O3S — CID 142134767
(3S)-3-(3-carbamimidoylanilino)-N-[4-(2-methylsulfonylphenyl)phenyl]heptanamide (PubChem CID 142134767) has the molecular formula C27H32N4O3S and a molecular weight of 492.65 g/mol. Its IUPAC name is (3S)-3-(3-carbamimidoylanilino)-N-[4-(2-methylsulfonylphenyl)phenyl]heptanamide.
| Compound Name | (3S)-3-(3-carbamimidoylanilino)-N-[4-(2-methylsulfonylphenyl)phenyl]heptanamide |
|---|---|
| PubChem CID | 142134767 |
| Molecular Formula | C27H32N4O3S |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | (3S)-3-(3-carbamimidoylanilino)-N-[4-(2-methylsulfonylphenyl)phenyl]heptanamide |
| SMILES | [H]/N=C(\N)c1cccc(N[C@@H](CCCC)CC(=O)Nc2ccc(-c3ccccc3S(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C27H32N4O3S/c1-3-4-9-23(30-22-10-7-8-20(17-22)27(28)29)18-26(32)31-21-15-13-19(14-16-21)24-11-5-6-12-25(24)35(2,33)34/h5-8,10-17,23,30H,3-4,9,18H2,1-2H3,(H3,28,29)(H,31,32)/t23-/m0/s1 |
| InChIKey | DFEXBXVYMUGULE-QHCPKHFHSA-N |
| XLogP | 5.04 |
| TPSA | 125.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|