C27H32N4O4S — CID 150604958
(3S)-3-[3-(N'-hydroxycarbamimidoyl)anilino]-4-methyl-N-[4-(2-methylsulfonylphenyl)phenyl]hexanamide (PubChem CID 150604958) has the molecular formula C27H32N4O4S and a molecular weight of 508.64 g/mol. Its IUPAC name is (3S)-3-[3-(N'-hydroxycarbamimidoyl)anilino]-4-methyl-N-[4-(2-methylsulfonylphenyl)phenyl]hexanamide.
| Compound Name | (3S)-3-[3-(N'-hydroxycarbamimidoyl)anilino]-4-methyl-N-[4-(2-methylsulfonylphenyl)phenyl]hexanamide |
|---|---|
| PubChem CID | 150604958 |
| Molecular Formula | C27H32N4O4S |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | (3S)-3-[3-(N'-hydroxycarbamimidoyl)anilino]-4-methyl-N-[4-(2-methylsulfonylphenyl)phenyl]hexanamide |
| SMILES | CCC(C)[C@H](CC(=O)Nc1ccc(-c2ccccc2S(C)(=O)=O)cc1)Nc1cccc(C(N)=NO)c1 |
| InChI | InChI=1S/C27H32N4O4S/c1-4-18(2)24(29-22-9-7-8-20(16-22)27(28)31-33)17-26(32)30-21-14-12-19(13-15-21)23-10-5-6-11-25(23)36(3,34)35/h5-16,18,24,29,33H,4,17H2,1-3H3,(H2,28,31)(H,30,32)/t18?,24-/m0/s1 |
| InChIKey | ISRGJXXMGBUUOJ-LUTIACGYSA-N |
| XLogP | 4.71 |
| TPSA | 133.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|