C33H35N5O5S — CID 10145644
2-methylpropyl (NZ)-N-[amino-[3-[2-benzyl-2-[[4-(2-methylsulfonylphenyl)phenyl]carbamoyl]hydrazinyl]phenyl]methylidene]carbamate (PubChem CID 10145644) has the molecular formula C33H35N5O5S and a molecular weight of 613.74 g/mol. Its IUPAC name is 2-methylpropyl (NZ)-N-[amino-[3-[2-benzyl-2-[[4-(2-methylsulfonylphenyl)phenyl]carbamoyl]hydrazinyl]phenyl]methylidene]carbamate.
| Compound Name | 2-methylpropyl (NZ)-N-[amino-[3-[2-benzyl-2-[[4-(2-methylsulfonylphenyl)phenyl]carbamoyl]hydrazinyl]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 10145644 |
| Molecular Formula | C33H35N5O5S |
| Molecular Weight | 613.74 g/mol |
| Exact Mass | 613.24 |
| IUPAC Name | 2-methylpropyl (NZ)-N-[amino-[3-[2-benzyl-2-[[4-(2-methylsulfonylphenyl)phenyl]carbamoyl]hydrazinyl]phenyl]methylidene]carbamate |
| SMILES | CC(C)COC(=O)/N=C(\N)c1cccc(NN(Cc2ccccc2)C(=O)Nc2ccc(-c3ccccc3S(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C33H35N5O5S/c1-23(2)22-43-33(40)36-31(34)26-12-9-13-28(20-26)37-38(21-24-10-5-4-6-11-24)32(39)35-27-18-16-25(17-19-27)29-14-7-8-15-30(29)44(3,41)42/h4-20,23,37H,21-22H2,1-3H3,(H,35,39)(H2,34,36,40) |
| InChIKey | OFXPEOFHKOGOCU-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 143.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.74 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|