C24H27N5O6S2 — CID 10211756
3-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-[methyl(methylsulfonyl)amino]-N-[4-(2-sulfamoylphenyl)phenyl]propanamide (PubChem CID 10211756) has the molecular formula C24H27N5O6S2 and a molecular weight of 545.64 g/mol. Its IUPAC name is 3-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-[methyl(methylsulfonyl)amino]-N-[4-(2-sulfamoylphenyl)phenyl]propanamide.
| Compound Name | 3-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-[methyl(methylsulfonyl)amino]-N-[4-(2-sulfamoylphenyl)phenyl]propanamide |
|---|---|
| PubChem CID | 10211756 |
| Molecular Formula | C24H27N5O6S2 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | 3-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-[methyl(methylsulfonyl)amino]-N-[4-(2-sulfamoylphenyl)phenyl]propanamide |
| SMILES | CN(C(Cc1cccc(/C(N)=N/O)c1)C(=O)Nc1ccc(-c2ccccc2S(N)(=O)=O)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C24H27N5O6S2/c1-29(36(2,32)33)21(15-16-6-5-7-18(14-16)23(25)28-31)24(30)27-19-12-10-17(11-13-19)20-8-3-4-9-22(20)37(26,34)35/h3-14,21,31H,15H2,1-2H3,(H2,25,28)(H,27,30)(H2,26,34,35) |
| InChIKey | BTKRYBBRZJBXHI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 185.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|