C28H27N5O4S — CID 91595301
1-[N-benzyl-3-(N'-hydroxycarbamimidoyl)anilino]-3-[4-(2-methylsulfonylphenyl)phenyl]urea (PubChem CID 91595301) has the molecular formula C28H27N5O4S and a molecular weight of 529.62 g/mol. Its IUPAC name is 1-[N-benzyl-3-(N'-hydroxycarbamimidoyl)anilino]-3-[4-(2-methylsulfonylphenyl)phenyl]urea.
| Compound Name | 1-[N-benzyl-3-(N'-hydroxycarbamimidoyl)anilino]-3-[4-(2-methylsulfonylphenyl)phenyl]urea |
|---|---|
| PubChem CID | 91595301 |
| Molecular Formula | C28H27N5O4S |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | 1-[N-benzyl-3-(N'-hydroxycarbamimidoyl)anilino]-3-[4-(2-methylsulfonylphenyl)phenyl]urea |
| SMILES | CS(=O)(=O)c1ccccc1-c1ccc(NC(=O)NN(Cc2ccccc2)c2cccc(C(N)=NO)c2)cc1 |
| InChI | InChI=1S/C28H27N5O4S/c1-38(36,37)26-13-6-5-12-25(26)21-14-16-23(17-15-21)30-28(34)31-33(19-20-8-3-2-4-9-20)24-11-7-10-22(18-24)27(29)32-35/h2-18,35H,19H2,1H3,(H2,29,32)(H2,30,31,34) |
| InChIKey | HETOOHQUHSUGEF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 137.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|