C27H23ClN4O4S — CID 12967430
1-[(4-chlorophenyl)carbamoylamino]-3-[4-(2-methylsulfonylphenyl)phenyl]-1-phenylurea (PubChem CID 12967430) has the molecular formula C27H23ClN4O4S and a molecular weight of 535.03 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)carbamoylamino]-3-[4-(2-methylsulfonylphenyl)phenyl]-1-phenylurea.
| Compound Name | 1-[(4-chlorophenyl)carbamoylamino]-3-[4-(2-methylsulfonylphenyl)phenyl]-1-phenylurea |
|---|---|
| PubChem CID | 12967430 |
| Molecular Formula | C27H23ClN4O4S |
| Molecular Weight | 535.03 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | 1-[(4-chlorophenyl)carbamoylamino]-3-[4-(2-methylsulfonylphenyl)phenyl]-1-phenylurea |
| SMILES | CS(=O)(=O)c1ccccc1-c1ccc(NC(=O)N(NC(=O)Nc2ccc(Cl)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H23ClN4O4S/c1-37(35,36)25-10-6-5-9-24(25)19-11-15-22(16-12-19)30-27(34)32(23-7-3-2-4-8-23)31-26(33)29-21-17-13-20(28)14-18-21/h2-18H,1H3,(H,30,34)(H2,29,31,33) |
| InChIKey | KBPSVCYOJHSTHE-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.03 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|