C24H20ClN5O3S — CID 1497964
3-(4-chlorophenyl)-1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-1-(phenylcarbamoylamino)urea (PubChem CID 1497964) has the molecular formula C24H20ClN5O3S and a molecular weight of 493.98 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-1-(phenylcarbamoylamino)urea.
| Compound Name | 3-(4-chlorophenyl)-1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-1-(phenylcarbamoylamino)urea |
|---|---|
| PubChem CID | 1497964 |
| Molecular Formula | C24H20ClN5O3S |
| Molecular Weight | 493.98 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-1-(phenylcarbamoylamino)urea |
| SMILES | COc1ccc(-c2csc(N(NC(=O)Nc3ccccc3)C(=O)Nc3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C24H20ClN5O3S/c1-33-20-13-7-16(8-14-20)21-15-34-24(28-21)30(23(32)27-19-11-9-17(25)10-12-19)29-22(31)26-18-5-3-2-4-6-18/h2-15H,1H3,(H,27,32)(H2,26,29,31) |
| InChIKey | ZBLWOZVTCATMEU-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.98 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|