C23H24BrN5O2S — CID 2718932
1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-1-(cyclohexylcarbamoylamino)-3-phenylurea (PubChem CID 2718932) has the molecular formula C23H24BrN5O2S and a molecular weight of 514.45 g/mol. Its IUPAC name is 1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-1-(cyclohexylcarbamoylamino)-3-phenylurea.
| Compound Name | 1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-1-(cyclohexylcarbamoylamino)-3-phenylurea |
|---|---|
| PubChem CID | 2718932 |
| Molecular Formula | C23H24BrN5O2S |
| Molecular Weight | 514.45 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | 1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-1-(cyclohexylcarbamoylamino)-3-phenylurea |
| SMILES | O=C(NC1CCCCC1)NN(C(=O)Nc1ccccc1)c1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C23H24BrN5O2S/c24-17-13-11-16(12-14-17)20-15-32-23(27-20)29(22(31)26-19-9-5-2-6-10-19)28-21(30)25-18-7-3-1-4-8-18/h2,5-6,9-15,18H,1,3-4,7-8H2,(H,26,31)(H2,25,28,30) |
| InChIKey | DCXZBPPMUATFCY-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.45 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|