C27H31N3O2S — CID 22433484
3-(3-acetylphenyl)-1-[4-(4-cyclohexylphenyl)-1,3-thiazol-2-yl]-1-propylurea (PubChem CID 22433484) has the molecular formula C27H31N3O2S and a molecular weight of 461.63 g/mol. Its IUPAC name is 3-(3-acetylphenyl)-1-[4-(4-cyclohexylphenyl)-1,3-thiazol-2-yl]-1-propylurea.
| Compound Name | 3-(3-acetylphenyl)-1-[4-(4-cyclohexylphenyl)-1,3-thiazol-2-yl]-1-propylurea |
|---|---|
| PubChem CID | 22433484 |
| Molecular Formula | C27H31N3O2S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 3-(3-acetylphenyl)-1-[4-(4-cyclohexylphenyl)-1,3-thiazol-2-yl]-1-propylurea |
| SMILES | CCCN(C(=O)Nc1cccc(C(C)=O)c1)c1nc(-c2ccc(C3CCCCC3)cc2)cs1 |
| InChI | InChI=1S/C27H31N3O2S/c1-3-16-30(26(32)28-24-11-7-10-23(17-24)19(2)31)27-29-25(18-33-27)22-14-12-21(13-15-22)20-8-5-4-6-9-20/h7,10-15,17-18,20H,3-6,8-9,16H2,1-2H3,(H,28,32) |
| InChIKey | OZVPGKHFEVLEJI-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |