C23H28N2O2S3 — CID 3930109
O-ethyl [2-[[4-(4-cyclohexylphenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]-2-oxoethyl]sulfanylmethanethioate (PubChem CID 3930109) has the molecular formula C23H28N2O2S3 and a molecular weight of 460.69 g/mol. Its IUPAC name is O-ethyl [2-[[4-(4-cyclohexylphenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]-2-oxoethyl]sulfanylmethanethioate.
| Compound Name | O-ethyl [2-[[4-(4-cyclohexylphenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]-2-oxoethyl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 3930109 |
| Molecular Formula | C23H28N2O2S3 |
| Molecular Weight | 460.69 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | O-ethyl [2-[[4-(4-cyclohexylphenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]-2-oxoethyl]sulfanylmethanethioate |
| SMILES | C=CCN(C(=O)CSC(=S)OCC)c1nc(-c2ccc(C3CCCCC3)cc2)cs1 |
| InChI | InChI=1S/C23H28N2O2S3/c1-3-14-25(21(26)16-30-23(28)27-4-2)22-24-20(15-29-22)19-12-10-18(11-13-19)17-8-6-5-7-9-17/h3,10-13,15,17H,1,4-9,14,16H2,2H3 |
| InChIKey | AJOJZDYZLCPGRR-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.69 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|