C25H28ClN3OS — CID 22433516
3-(2-chlorophenyl)-1-[4-(4-cyclohexylphenyl)-1,3-thiazol-2-yl]-1-propylurea (PubChem CID 22433516) has the molecular formula C25H28ClN3OS and a molecular weight of 454.04 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1-[4-(4-cyclohexylphenyl)-1,3-thiazol-2-yl]-1-propylurea.
| Compound Name | 3-(2-chlorophenyl)-1-[4-(4-cyclohexylphenyl)-1,3-thiazol-2-yl]-1-propylurea |
|---|---|
| PubChem CID | 22433516 |
| Molecular Formula | C25H28ClN3OS |
| Molecular Weight | 454.04 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 3-(2-chlorophenyl)-1-[4-(4-cyclohexylphenyl)-1,3-thiazol-2-yl]-1-propylurea |
| SMILES | CCCN(C(=O)Nc1ccccc1Cl)c1nc(-c2ccc(C3CCCCC3)cc2)cs1 |
| InChI | InChI=1S/C25H28ClN3OS/c1-2-16-29(24(30)27-22-11-7-6-10-21(22)26)25-28-23(17-31-25)20-14-12-19(13-15-20)18-8-4-3-5-9-18/h6-7,10-15,17-18H,2-5,8-9,16H2,1H3,(H,27,30) |
| InChIKey | ZACFSONIULIEHW-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.04 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |