C25H35N3O5S — CID 171667862
N-[3-(diethylamino)propyl]-N-(4-phenyl-1,3-thiazol-2-yl)cyclohexanecarboxamide;oxalic acid (PubChem CID 171667862) has the molecular formula C25H35N3O5S and a molecular weight of 489.64 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-N-(4-phenyl-1,3-thiazol-2-yl)cyclohexanecarboxamide;oxalic acid.
| Compound Name | N-[3-(diethylamino)propyl]-N-(4-phenyl-1,3-thiazol-2-yl)cyclohexanecarboxamide;oxalic acid |
|---|---|
| PubChem CID | 171667862 |
| Molecular Formula | C25H35N3O5S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | N-[3-(diethylamino)propyl]-N-(4-phenyl-1,3-thiazol-2-yl)cyclohexanecarboxamide;oxalic acid |
| SMILES | CCN(CC)CCCN(C(=O)C1CCCCC1)c1nc(-c2ccccc2)cs1.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H33N3OS.C2H2O4/c1-3-25(4-2)16-11-17-26(22(27)20-14-9-6-10-15-20)23-24-21(18-28-23)19-12-7-5-8-13-19;3-1(4)2(5)6/h5,7-8,12-13,18,20H,3-4,6,9-11,14-17H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | GRFNOJPELZKXMB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 111.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|