C20H18N2OS — CID 3173507
N-benzyl-N-(4-phenyl-1,3-thiazol-2-yl)cyclopropanecarboxamide (PubChem CID 3173507) has the molecular formula C20H18N2OS and a molecular weight of 334.44 g/mol. Its IUPAC name is N-benzyl-N-(4-phenyl-1,3-thiazol-2-yl)cyclopropanecarboxamide.
| Compound Name | N-benzyl-N-(4-phenyl-1,3-thiazol-2-yl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 3173507 |
| Molecular Formula | C20H18N2OS |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N-benzyl-N-(4-phenyl-1,3-thiazol-2-yl)cyclopropanecarboxamide |
| SMILES | O=C(C1CC1)N(Cc1ccccc1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C20H18N2OS/c23-19(17-11-12-17)22(13-15-7-3-1-4-8-15)20-21-18(14-24-20)16-9-5-2-6-10-16/h1-10,14,17H,11-13H2 |
| InChIKey | FOINHSCTYXGAIY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |