C21H21BrN2O2S — CID 56500554
N-benzyl-N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-ethoxypropanamide (PubChem CID 56500554) has the molecular formula C21H21BrN2O2S and a molecular weight of 445.38 g/mol. Its IUPAC name is N-benzyl-N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-ethoxypropanamide.
| Compound Name | N-benzyl-N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-ethoxypropanamide |
|---|---|
| PubChem CID | 56500554 |
| Molecular Formula | C21H21BrN2O2S |
| Molecular Weight | 445.38 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | N-benzyl-N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-ethoxypropanamide |
| SMILES | CCOCCC(=O)N(Cc1ccccc1)c1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C21H21BrN2O2S/c1-2-26-13-12-20(25)24(14-16-6-4-3-5-7-16)21-23-19(15-27-21)17-8-10-18(22)11-9-17/h3-11,15H,2,12-14H2,1H3 |
| InChIKey | XMXYRQNMFJKFQV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.38 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|