C25H22N2OS — CID 1175892
N-benzyl-2-methyl-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 1175892) has the molecular formula C25H22N2OS and a molecular weight of 398.53 g/mol. Its IUPAC name is N-benzyl-2-methyl-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | N-benzyl-2-methyl-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 1175892 |
| Molecular Formula | C25H22N2OS |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-benzyl-2-methyl-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | Cc1ccc(-c2csc(N(Cc3ccccc3)C(=O)c3ccccc3C)n2)cc1 |
| InChI | InChI=1S/C25H22N2OS/c1-18-12-14-21(15-13-18)23-17-29-25(26-23)27(16-20-9-4-3-5-10-20)24(28)22-11-7-6-8-19(22)2/h3-15,17H,16H2,1-2H3 |
| InChIKey | WSPFUMVURHJSLC-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |