C18H15FN2OS — CID 857526
N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N,2-dimethylbenzamide (PubChem CID 857526) has the molecular formula C18H15FN2OS and a molecular weight of 326.40 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N,2-dimethylbenzamide.
| Compound Name | N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 857526 |
| Molecular Formula | C18H15FN2OS |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N,2-dimethylbenzamide |
| SMILES | Cc1ccccc1C(=O)N(C)c1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C18H15FN2OS/c1-12-5-3-4-6-15(12)17(22)21(2)18-20-16(11-23-18)13-7-9-14(19)10-8-13/h3-11H,1-2H3 |
| InChIKey | PFSMAJMEGYQDOA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |