C18H16N2O2S — CID 67146644
4-[[methyl-(4-phenyl-1,3-thiazol-2-yl)amino]methyl]benzoic acid (PubChem CID 67146644) has the molecular formula C18H16N2O2S and a molecular weight of 324.41 g/mol. Its IUPAC name is 4-[[methyl-(4-phenyl-1,3-thiazol-2-yl)amino]methyl]benzoic acid.
| Compound Name | 4-[[methyl-(4-phenyl-1,3-thiazol-2-yl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 67146644 |
| Molecular Formula | C18H16N2O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 4-[[methyl-(4-phenyl-1,3-thiazol-2-yl)amino]methyl]benzoic acid |
| SMILES | CN(Cc1ccc(C(=O)O)cc1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H16N2O2S/c1-20(11-13-7-9-15(10-8-13)17(21)22)18-19-16(12-23-18)14-5-3-2-4-6-14/h2-10,12H,11H2,1H3,(H,21,22) |
| InChIKey | DIIICPZMZDLKQA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |