C24H23N3O2S — CID 18079930
1-benzyl-5-oxo-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylpyrrolidine-3-carboxamide (PubChem CID 18079930) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is 1-benzyl-5-oxo-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylpyrrolidine-3-carboxamide.
| Compound Name | 1-benzyl-5-oxo-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 18079930 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 1-benzyl-5-oxo-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylpyrrolidine-3-carboxamide |
| SMILES | C=CCN(C(=O)C1CC(=O)N(Cc2ccccc2)C1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C24H23N3O2S/c1-2-13-27(24-25-21(17-30-24)19-11-7-4-8-12-19)23(29)20-14-22(28)26(16-20)15-18-9-5-3-6-10-18/h2-12,17,20H,1,13-16H2 |
| InChIKey | PWDKMKGOMPWIPD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|