C20H20N2OS — CID 98180033
(1R,2R,4S)-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylbicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 98180033) has the molecular formula C20H20N2OS and a molecular weight of 336.46 g/mol. Its IUPAC name is (1R,2R,4S)-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylbicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2R,4S)-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylbicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 98180033 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (1R,2R,4S)-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylbicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | C=CCN(C(=O)[C@@H]1C[C@H]2C=C[C@H]1C2)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C20H20N2OS/c1-2-10-22(19(23)17-12-14-8-9-16(17)11-14)20-21-18(13-24-20)15-6-4-3-5-7-15/h2-9,13-14,16-17H,1,10-12H2/t14-,16-,17+/m0/s1 |
| InChIKey | IKHQTGLKWOASOC-BHYGNILZSA-N |
| XLogP | 4.54 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|