C27H31N5OS — CID 9891030
(R,S)-4-methyl-2-[3''-(2-piperazin-1-yl-thiazol-4-yl)-biphenyl-3-yl]-pentanoic acid cyanomethyl-amide (PubChem CID 9891030) has the molecular formula C27H31N5OS and a molecular weight of 473.60 g/mol. Its IUPAC name is N-(cyanomethyl)-4-methyl-2-[3-[3-(2-piperazin-1-yl-1,3-thiazol-4-yl)phenyl]phenyl]pentanamide.
| Compound Name | (R,S)-4-methyl-2-[3''-(2-piperazin-1-yl-thiazol-4-yl)-biphenyl-3-yl]-pentanoic acid cyanomethyl-amide |
|---|---|
| PubChem CID | 9891030 |
| Molecular Formula | C27H31N5OS |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | N-(cyanomethyl)-4-methyl-2-[3-[3-(2-piperazin-1-yl-1,3-thiazol-4-yl)phenyl]phenyl]pentanamide |
| SMILES | CC(C)CC(C1=CC=CC(=C1)C2=CC(=CC=C2)C3=CSC(=N3)N4CCNCC4)C(=O)NCC#N |
| InChI | InChI=1S/C27H31N5OS/c1-19(2)15-24(26(33)30-10-9-28)22-7-3-5-20(16-22)21-6-4-8-23(17-21)25-18-34-27(31-25)32-13-11-29-12-14-32/h3-8,16-19,24,29H,10-15H2,1-2H3,(H,30,33) |
| InChIKey | OXTNJKCSQHCZQO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | 702 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|