C19H16N2OS — CID 2675968
N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylbenzamide (PubChem CID 2675968) has the molecular formula C19H16N2OS and a molecular weight of 320.42 g/mol. Its IUPAC name is N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylbenzamide.
| Compound Name | N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 2675968 |
| Molecular Formula | C19H16N2OS |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylbenzamide |
| SMILES | C=CCN(C(=O)c1ccccc1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C19H16N2OS/c1-2-13-21(18(22)16-11-7-4-8-12-16)19-20-17(14-23-19)15-9-5-3-6-10-15/h2-12,14H,1,13H2 |
| InChIKey | WUGXXGFATNYKOR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|