C25H20N2O2S — CID 3298434
3-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylbenzamide (PubChem CID 3298434) has the molecular formula C25H20N2O2S and a molecular weight of 412.51 g/mol. Its IUPAC name is 3-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylbenzamide.
| Compound Name | 3-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 3298434 |
| Molecular Formula | C25H20N2O2S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 3-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylbenzamide |
| SMILES | C=CCN(C(=O)c1cccc(Oc2ccccc2)c1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C25H20N2O2S/c1-2-16-27(25-26-23(18-30-25)19-10-5-3-6-11-19)24(28)20-12-9-15-22(17-20)29-21-13-7-4-8-14-21/h2-15,17-18H,1,16H2 |
| InChIKey | VHLHRVKNYBTRKE-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|