C21H18N2O4S — CID 7483824
[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylamino]ethyl] 3-hydroxybenzoate (PubChem CID 7483824) has the molecular formula C21H18N2O4S and a molecular weight of 394.45 g/mol. Its IUPAC name is [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylamino]ethyl] 3-hydroxybenzoate.
| Compound Name | [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylamino]ethyl] 3-hydroxybenzoate |
|---|---|
| PubChem CID | 7483824 |
| Molecular Formula | C21H18N2O4S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylamino]ethyl] 3-hydroxybenzoate |
| SMILES | C=CCN(C(=O)COC(=O)c1cccc(O)c1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C21H18N2O4S/c1-2-11-23(21-22-18(14-28-21)15-7-4-3-5-8-15)19(25)13-27-20(26)16-9-6-10-17(24)12-16/h2-10,12,14,24H,1,11,13H2 |
| InChIKey | HBLASBQRQRVKFC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|