C18H18N2O3S2 — CID 134030582
2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylacetamide (PubChem CID 134030582) has the molecular formula C18H18N2O3S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylacetamide.
| Compound Name | 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 134030582 |
| Molecular Formula | C18H18N2O3S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)CC1C=CS(=O)(=O)C1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H18N2O3S2/c1-2-9-20(17(21)11-14-8-10-25(22,23)13-14)18-19-16(12-24-18)15-6-4-3-5-7-15/h2-8,10,12,14H,1,9,11,13H2 |
| InChIKey | JMETXGBZGVAQLC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|