C27H20N4O2S — CID 24591343
4-(5-phenyl-1,3,4-oxadiazol-2-yl)-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylbenzamide (PubChem CID 24591343) has the molecular formula C27H20N4O2S and a molecular weight of 464.55 g/mol. Its IUPAC name is 4-(5-phenyl-1,3,4-oxadiazol-2-yl)-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylbenzamide.
| Compound Name | 4-(5-phenyl-1,3,4-oxadiazol-2-yl)-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 24591343 |
| Molecular Formula | C27H20N4O2S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 4-(5-phenyl-1,3,4-oxadiazol-2-yl)-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylbenzamide |
| SMILES | C=CCN(C(=O)c1ccc(-c2nnc(-c3ccccc3)o2)cc1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C27H20N4O2S/c1-2-17-31(27-28-23(18-34-27)19-9-5-3-6-10-19)26(32)22-15-13-21(14-16-22)25-30-29-24(33-25)20-11-7-4-8-12-20/h2-16,18H,1,17H2 |
| InChIKey | UIMPMFZBQARXKV-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 72.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|