C23H21N5OS — CID 43069032
6-(3,5-dimethylpyrazol-1-yl)-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylpyridine-3-carboxamide (PubChem CID 43069032) has the molecular formula C23H21N5OS and a molecular weight of 415.52 g/mol. Its IUPAC name is 6-(3,5-dimethylpyrazol-1-yl)-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylpyridine-3-carboxamide.
| Compound Name | 6-(3,5-dimethylpyrazol-1-yl)-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 43069032 |
| Molecular Formula | C23H21N5OS |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 6-(3,5-dimethylpyrazol-1-yl)-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylpyridine-3-carboxamide |
| SMILES | C=CCN(C(=O)c1ccc(-n2nc(C)cc2C)nc1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C23H21N5OS/c1-4-12-27(23-25-20(15-30-23)18-8-6-5-7-9-18)22(29)19-10-11-21(24-14-19)28-17(3)13-16(2)26-28/h4-11,13-15H,1,12H2,2-3H3 |
| InChIKey | WHBLOVPHIIELRW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|