C27H23N3O2S — CID 55630363
3-benzamido-4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylbenzamide (PubChem CID 55630363) has the molecular formula C27H23N3O2S and a molecular weight of 453.57 g/mol. Its IUPAC name is 3-benzamido-4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylbenzamide.
| Compound Name | 3-benzamido-4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 55630363 |
| Molecular Formula | C27H23N3O2S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 3-benzamido-4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylbenzamide |
| SMILES | C=CCN(C(=O)c1ccc(C)c(NC(=O)c2ccccc2)c1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C27H23N3O2S/c1-3-16-30(27-29-24(18-33-27)20-10-6-4-7-11-20)26(32)22-15-14-19(2)23(17-22)28-25(31)21-12-8-5-9-13-21/h3-15,17-18H,1,16H2,2H3,(H,28,31) |
| InChIKey | BDDJEBWRUWYITF-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|