C21H17N3O5S — CID 26212430
methyl 3-nitro-5-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylcarbamoyl]benzoate (PubChem CID 26212430) has the molecular formula C21H17N3O5S and a molecular weight of 423.45 g/mol. Its IUPAC name is methyl 3-nitro-5-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylcarbamoyl]benzoate.
| Compound Name | methyl 3-nitro-5-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 26212430 |
| Molecular Formula | C21H17N3O5S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | methyl 3-nitro-5-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylcarbamoyl]benzoate |
| SMILES | C=CCN(C(=O)c1cc(C(=O)OC)cc([N+](=O)[O-])c1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C21H17N3O5S/c1-3-9-23(21-22-18(13-30-21)14-7-5-4-6-8-14)19(25)15-10-16(20(26)29-2)12-17(11-15)24(27)28/h3-8,10-13H,1,9H2,2H3 |
| InChIKey | LDQUPBUMTYDZST-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|