About methyl 3-nitro-5-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylcarbamoyl]benzoate
methyl 3-nitro-5-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylcarbamoyl]benzoate (PubChem CID 26212430) has the molecular formula C21H17N3O5S
and a molecular weight of 423.45 g/mol. Its IUPAC name is methyl 3-nitro-5-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylcarbamoyl]benzoate.
Molecular Properties
| Compound Name | methyl 3-nitro-5-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylcarbamoyl]benzoate |
| PubChem CID | 26212430 |
| Molecular Formula | C21H17N3O5S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | methyl 3-nitro-5-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylcarbamoyl]benzoate |
| SMILES | C=CCN(C(=O)c1cc(C(=O)OC)cc([N+](=O)[O-])c1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C21H17N3O5S/c1-3-9-23(21-22-18(13-30-21)14-7-5-4-6-8-14)19(25)15-10-16(20(26)29-2)12-17(11-15)24(27)28/h3-8,10-13H,1,9H2,2H3 |
| InChIKey | LDQUPBUMTYDZST-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-nitro-5-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylcarbamoyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-nitro-5-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylcarbamoyl]benzoate?
The IUPAC name of methyl 3-nitro-5-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylcarbamoyl]benzoate (CID 26212430) is methyl 3-nitro-5-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylcarbamoyl]benzoate.
What is the SMILES notation for methyl 3-nitro-5-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylcarbamoyl]benzoate?
The canonical SMILES for methyl 3-nitro-5-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylcarbamoyl]benzoate is C=CCN(C(=O)c1cc(C(=O)OC)cc([N+](=O)[O-])c1)c1nc(-c2ccccc2)cs1.
What is the InChIKey of methyl 3-nitro-5-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylcarbamoyl]benzoate?
The InChIKey is LDQUPBUMTYDZST-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N3O5S/c1-3-9-23(21-22-18(13-30-21)14-7-5-4-6-8-14)19(25)15-10-16(20(26)29-2)12-17(11-15)24(27)28/h3-8,10-13H,1,9H2,2H3.
What are the key properties of methyl 3-nitro-5-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylcarbamoyl]benzoate?
methyl 3-nitro-5-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylcarbamoyl]benzoate has a molecular weight of 423.45 g/mol, XLogP of 4.34, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-nitro-5-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylcarbamoyl]benzoate is sourced from PubChem (CID 26212430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).