C21H19N3O3S — CID 39992831
methyl N-[4-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylcarbamoyl]phenyl]carbamate (PubChem CID 39992831) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is methyl N-[4-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylcarbamoyl]phenyl]carbamate.
| Compound Name | methyl N-[4-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylcarbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 39992831 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | methyl N-[4-[(4-phenyl-1,3-thiazol-2-yl)-prop-2-enylcarbamoyl]phenyl]carbamate |
| SMILES | C=CCN(C(=O)c1ccc(NC(=O)OC)cc1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C21H19N3O3S/c1-3-13-24(20-23-18(14-28-20)15-7-5-4-6-8-15)19(25)16-9-11-17(12-10-16)22-21(26)27-2/h3-12,14H,1,13H2,2H3,(H,22,26) |
| InChIKey | ZPJIAZVZGQWADR-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|