C24H23N3O2S — CID 55787443
N-(4-phenyl-1,3-thiazol-2-yl)-1-propanoyl-N-prop-2-enyl-2,3-dihydroindole-5-carboxamide (PubChem CID 55787443) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is N-(4-phenyl-1,3-thiazol-2-yl)-1-propanoyl-N-prop-2-enyl-2,3-dihydroindole-5-carboxamide.
| Compound Name | N-(4-phenyl-1,3-thiazol-2-yl)-1-propanoyl-N-prop-2-enyl-2,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 55787443 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-(4-phenyl-1,3-thiazol-2-yl)-1-propanoyl-N-prop-2-enyl-2,3-dihydroindole-5-carboxamide |
| SMILES | C=CCN(C(=O)c1ccc2c(c1)CCN2C(=O)CC)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C24H23N3O2S/c1-3-13-27(24-25-20(16-30-24)17-8-6-5-7-9-17)23(29)19-10-11-21-18(15-19)12-14-26(21)22(28)4-2/h3,5-11,15-16H,1,4,12-14H2,2H3 |
| InChIKey | PURWCIJWGPRWHF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|