C17H17N5OS2 — CID 4828424
2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylacetamide (PubChem CID 4828424) has the molecular formula C17H17N5OS2 and a molecular weight of 371.49 g/mol. Its IUPAC name is 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylacetamide.
| Compound Name | 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 4828424 |
| Molecular Formula | C17H17N5OS2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)CSc1nncn1C)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C17H17N5OS2/c1-3-9-22(15(23)11-25-17-20-18-12-21(17)2)16-19-14(10-24-16)13-7-5-4-6-8-13/h3-8,10,12H,1,9,11H2,2H3 |
| InChIKey | LXWHIWCRVPCPPO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|