C17H15N5O3S — CID 47045980
2-(3-nitropyrazol-1-yl)-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylacetamide (PubChem CID 47045980) has the molecular formula C17H15N5O3S and a molecular weight of 369.41 g/mol. Its IUPAC name is 2-(3-nitropyrazol-1-yl)-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylacetamide.
| Compound Name | 2-(3-nitropyrazol-1-yl)-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 47045980 |
| Molecular Formula | C17H15N5O3S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 2-(3-nitropyrazol-1-yl)-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)Cn1ccc([N+](=O)[O-])n1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C17H15N5O3S/c1-2-9-21(16(23)11-20-10-8-15(19-20)22(24)25)17-18-14(12-26-17)13-6-4-3-5-7-13/h2-8,10,12H,1,9,11H2 |
| InChIKey | QIBSZLLXIZMCMB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|