C21H18N6O2S2 — CID 4828551
2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylacetamide (PubChem CID 4828551) has the molecular formula C21H18N6O2S2 and a molecular weight of 450.55 g/mol. Its IUPAC name is 2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylacetamide.
| Compound Name | 2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 4828551 |
| Molecular Formula | C21H18N6O2S2 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)CSc1nnnn1-c1ccc(O)cc1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C21H18N6O2S2/c1-2-12-26(20-22-18(13-30-20)15-6-4-3-5-7-15)19(29)14-31-21-23-24-25-27(21)16-8-10-17(28)11-9-16/h2-11,13,28H,1,12,14H2 |
| InChIKey | ZHEMNYCTUBLXOJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|