C25H24N2O2 — CID 75981218
N,1-dibenzyl-5-oxo-N-phenylpyrrolidine-3-carboxamide (PubChem CID 75981218) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is N,1-dibenzyl-5-oxo-N-phenylpyrrolidine-3-carboxamide.
| Compound Name | N,1-dibenzyl-5-oxo-N-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 75981218 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | N,1-dibenzyl-5-oxo-N-phenylpyrrolidine-3-carboxamide |
| SMILES | O=C1CC(C(=O)N(Cc2ccccc2)c2ccccc2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C25H24N2O2/c28-24-16-22(19-26(24)17-20-10-4-1-5-11-20)25(29)27(23-14-8-3-9-15-23)18-21-12-6-2-7-13-21/h1-15,22H,16-19H2 |
| InChIKey | WWAAYWFKIJXJCK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |