C20H21FN2O2 — CID 34904790
(3S)-1-benzyl-N-[(3-fluorophenyl)methyl]-N-methyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 34904790) has the molecular formula C20H21FN2O2 and a molecular weight of 340.40 g/mol. Its IUPAC name is (3S)-1-benzyl-N-[(3-fluorophenyl)methyl]-N-methyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-benzyl-N-[(3-fluorophenyl)methyl]-N-methyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 34904790 |
| Molecular Formula | C20H21FN2O2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (3S)-1-benzyl-N-[(3-fluorophenyl)methyl]-N-methyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | CN(Cc1cccc(F)c1)C(=O)[C@H]1CC(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H21FN2O2/c1-22(12-16-8-5-9-18(21)10-16)20(25)17-11-19(24)23(14-17)13-15-6-3-2-4-7-15/h2-10,17H,11-14H2,1H3/t17-/m0/s1 |
| InChIKey | XHKPFFWZPZSEJS-KRWDZBQOSA-N |
| XLogP | 2.83 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |